ChemNet > CAS > 4108-58-1 (S)-(-)-N-Benzoyl-alpha-methylbenzylamine
4108-58-1 (S)-(-)-N-Benzoyl-alpha-methylbenzylamine
| product Name |
(S)-(-)-N-Benzoyl-alpha-methylbenzylamine |
| CAS No |
4108-58-1 |
| Synonyms |
N-[(1S)-1-Phenylethyl]benzamide |
| Molecular Formula |
C15H15NO |
| Molecular Weight |
225.2857 |
| InChI |
InChI=1/C15H15NO/c1-12(13-8-4-2-5-9-13)16-15(17)14-10-6-3-7-11-14/h2-12H,1H3,(H,16,17)/t12-/m0/s1 |
| Molecular Structure |
|
| Density |
1.084g/cm3 |
| Melting point |
119℃ |
| Boiling point |
422.8°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
254.9°C |
| Vapour Pressur |
2.34E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
